C20H25ClN2O2 — CID 109025421
N-(2-chloro-4,6-dimethylphenyl)-3-[2-(2-methoxyphenyl)ethylamino]propanamide (PubChem CID 109025421) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-[2-(2-methoxyphenyl)ethylamino]propanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-[2-(2-methoxyphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109025421 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-[2-(2-methoxyphenyl)ethylamino]propanamide |
| SMILES | COc1ccccc1CCNCCC(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C20H25ClN2O2/c1-14-12-15(2)20(17(21)13-14)23-19(24)9-11-22-10-8-16-6-4-5-7-18(16)25-3/h4-7,12-13,22H,8-11H2,1-3H3,(H,23,24) |
| InChIKey | QRILWNYNQPTVMB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|