C23H30N2O2S2 — CID 18272553
4-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 18272553) has the molecular formula C23H30N2O2S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 4-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 18272553 |
| Molecular Formula | C23H30N2O2S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]sulfanyl-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCSCC(=O)NCCSc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O2S2/c1-17-14-18(2)23(19(3)15-17)25-21(26)10-7-12-28-16-22(27)24-11-13-29-20-8-5-4-6-9-20/h4-6,8-9,14-15H,7,10-13,16H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | YWPXKKJKVMEKMS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|