C13H19NO2S2 — CID 66126582
2-(3-hydroxypropylsulfanyl)-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 66126582) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 2-(3-hydroxypropylsulfanyl)-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-(3-hydroxypropylsulfanyl)-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 66126582 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-(3-hydroxypropylsulfanyl)-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | O=C(CSCCCO)NCCSc1ccccc1 |
| InChI | InChI=1S/C13H19NO2S2/c15-8-4-9-17-11-13(16)14-7-10-18-12-5-2-1-3-6-12/h1-3,5-6,15H,4,7-11H2,(H,14,16) |
| InChIKey | FIFPAKLWJCZTPF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|