C16H15F2NOS2 — CID 9483105
2-(2,5-difluorophenyl)sulfanyl-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 9483105) has the molecular formula C16H15F2NOS2 and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanyl-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)sulfanyl-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 9483105 |
| Molecular Formula | C16H15F2NOS2 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfanyl-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | O=C(CSc1cc(F)ccc1F)NCCSc1ccccc1 |
| InChI | InChI=1S/C16H15F2NOS2/c17-12-6-7-14(18)15(10-12)22-11-16(20)19-8-9-21-13-4-2-1-3-5-13/h1-7,10H,8-9,11H2,(H,19,20) |
| InChIKey | RNBWLLUEFVSVDR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|