C17H17FN2O2S — CID 9371567
2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 9371567) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 9371567 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[(Z)-(2-fluorophenyl)methylideneamino]oxy-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | O=C(CO/N=C\c1ccccc1F)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H17FN2O2S/c18-16-9-5-4-6-14(16)12-20-22-13-17(21)19-10-11-23-15-7-2-1-3-8-15/h1-9,12H,10-11,13H2,(H,19,21)/b20-12- |
| InChIKey | GYFVLCJRMVEFOK-NDENLUEZSA-N |
| XLogP | 3.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|