C18H18F2N2O2S — CID 42103921
2,4-difluoro-N-[3-oxo-3-(2-phenylsulfanylethylamino)propyl]benzamide (PubChem CID 42103921) has the molecular formula C18H18F2N2O2S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-oxo-3-(2-phenylsulfanylethylamino)propyl]benzamide.
| Compound Name | 2,4-difluoro-N-[3-oxo-3-(2-phenylsulfanylethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 42103921 |
| Molecular Formula | C18H18F2N2O2S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2,4-difluoro-N-[3-oxo-3-(2-phenylsulfanylethylamino)propyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccc(F)cc1F)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H18F2N2O2S/c19-13-6-7-15(16(20)12-13)18(24)22-9-8-17(23)21-10-11-25-14-4-2-1-3-5-14/h1-7,12H,8-11H2,(H,21,23)(H,22,24) |
| InChIKey | HMKVLQMRQSODCA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|