C20H19FN4OS2 — CID 16620259
2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 16620259) has the molecular formula C20H19FN4OS2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 16620259 |
| Molecular Formula | C20H19FN4OS2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(/C=C/c2ccc(F)cc2)n1)NCCSc1ccccc1 |
| InChI | InChI=1S/C20H19FN4OS2/c21-16-9-6-15(7-10-16)8-11-18-23-20(25-24-18)28-14-19(26)22-12-13-27-17-4-2-1-3-5-17/h1-11H,12-14H2,(H,22,26)(H,23,24,25)/b11-8+ |
| InChIKey | KWXCZTWOKRENIT-DHZHZOJOSA-N |
| XLogP | 4.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|