C19H16FN5O2S — CID 16620144
N'-[2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 16620144) has the molecular formula C19H16FN5O2S and a molecular weight of 397.44 g/mol. Its IUPAC name is N'-[2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 16620144 |
| Molecular Formula | C19H16FN5O2S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N'-[2-[[5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1n[nH]c(/C=C/c2ccc(F)cc2)n1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16FN5O2S/c20-15-9-6-13(7-10-15)8-11-16-21-19(25-22-16)28-12-17(26)23-24-18(27)14-4-2-1-3-5-14/h1-11H,12H2,(H,23,26)(H,24,27)(H,21,22,25)/b11-8+ |
| InChIKey | SDDIMJRTNAIBSI-DHZHZOJOSA-N |
| XLogP | 2.67 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|