C17H9F6N3S — CID 16620216
5-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1H-1,2,4-triazole (PubChem CID 16620216) has the molecular formula C17H9F6N3S and a molecular weight of 401.34 g/mol. Its IUPAC name is 5-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 16620216 |
| Molecular Formula | C17H9F6N3S |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 5-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-1H-1,2,4-triazole |
| SMILES | Fc1ccc(/C=C/c2nc(SCc3c(F)c(F)c(F)c(F)c3F)n[nH]2)cc1 |
| InChI | InChI=1S/C17H9F6N3S/c18-9-4-1-8(2-5-9)3-6-11-24-17(26-25-11)27-7-10-12(19)14(21)16(23)15(22)13(10)20/h1-6H,7H2,(H,24,25,26)/b6-3+ |
| InChIKey | BIZBFFVJSCYWMX-ZZXKWVIFSA-N |
| XLogP | 5.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|