C14H12Cl2FN3S — CID 16612753
3-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole (PubChem CID 16612753) has the molecular formula C14H12Cl2FN3S and a molecular weight of 344.24 g/mol. Its IUPAC name is 3-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole.
| Compound Name | 3-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 16612753 |
| Molecular Formula | C14H12Cl2FN3S |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 3-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole |
| SMILES | Fc1ccc(/C=C/c2nc(SCC3CC3(Cl)Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C14H12Cl2FN3S/c15-14(16)7-10(14)8-21-13-18-12(19-20-13)6-3-9-1-4-11(17)5-2-9/h1-6,10H,7-8H2,(H,18,19,20)/b6-3+ |
| InChIKey | RXXAXDKTFAOKIF-ZZXKWVIFSA-N |
| XLogP | 4.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|