C10H11F2NOS — CID 103603525
2,2-difluoro-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 103603525) has the molecular formula C10H11F2NOS and a molecular weight of 231.27 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2,2-difluoro-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 103603525 |
| Molecular Formula | C10H11F2NOS |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2,2-difluoro-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | O=C(NCCSc1ccccc1)C(F)F |
| InChI | InChI=1S/C10H11F2NOS/c11-9(12)10(14)13-6-7-15-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14) |
| InChIKey | XNUDBZASZTZMRN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|