C16H10F7NO — CID 130474104
3-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 130474104) has the molecular formula C16H10F7NO and a molecular weight of 365.25 g/mol. Its IUPAC name is 3-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 130474104 |
| Molecular Formula | C16H10F7NO |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C16H10F7NO/c17-11-10(16(21,22)23)12(18)14(20)15(13(11)19)24-9(25)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,24,25) |
| InChIKey | FJQNVFBTLYFYSH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|