C23H15F7N2O2S — CID 23101565
N-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 23101565) has the molecular formula C23H15F7N2O2S and a molecular weight of 516.44 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23101565 |
| Molecular Formula | C23H15F7N2O2S |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | N-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(SCC(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H15F7N2O2S/c24-18-17(23(28,29)30)19(25)21(27)22(20(18)26)32-16(34)11-35-14-8-6-13(7-9-14)31-15(33)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,31,33)(H,32,34) |
| InChIKey | GBCABWSAGPFJND-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|