C30H9F17 — CID 166974251
9-[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octafluoro-10-[3-methyl-5-(trifluoromethyl)phenyl]anthracene (PubChem CID 166974251) has the molecular formula C30H9F17 and a molecular weight of 692.37 g/mol. Its IUPAC name is 9-[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octafluoro-10-[3-methyl-5-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 9-[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octafluoro-10-[3-methyl-5-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 166974251 |
| Molecular Formula | C30H9F17 |
| Molecular Weight | 692.37 g/mol |
| Exact Mass | 692.04 |
| IUPAC Name | 9-[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octafluoro-10-[3-methyl-5-(trifluoromethyl)phenyl]anthracene |
| SMILES | Cc1cc(-c2c3c(F)c(F)c(F)c(F)c3c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3c(F)c(F)c(F)c(F)c23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H9F17/c1-8-2-9(4-11(3-8)28(39,40)41)14-16-18(22(33)26(37)24(35)20(16)31)15(19-17(14)21(32)25(36)27(38)23(19)34)10-5-12(29(42,43)44)7-13(6-10)30(45,46)47/h2-7H,1H3 |
| InChIKey | HNGBSVRAUIKJKP-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.37 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|