C45H10BF30N6- — CID 139137023
tris[3-[3,5-bis(trifluoromethyl)phenyl]-4,5,6,7-tetrafluoroindazol-1-yl]boranuide (PubChem CID 139137023) has the molecular formula C45H10BF30N6- and a molecular weight of 1215.37 g/mol. Its IUPAC name is tris[3-[3,5-bis(trifluoromethyl)phenyl]-4,5,6,7-tetrafluoroindazol-1-yl]boranuide.
| Compound Name | tris[3-[3,5-bis(trifluoromethyl)phenyl]-4,5,6,7-tetrafluoroindazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139137023 |
| Molecular Formula | C45H10BF30N6- |
| Molecular Weight | 1215.37 g/mol |
| Exact Mass | 1215.06 |
| IUPAC Name | tris[3-[3,5-bis(trifluoromethyl)phenyl]-4,5,6,7-tetrafluoroindazol-1-yl]boranuide |
| SMILES | Fc1c(F)c(F)c2c(c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nn2[BH-](n2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3c(F)c(F)c(F)c(F)c32)n2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3c(F)c(F)c(F)c(F)c32)c1F |
| InChI | InChI=1S/C45H10BF30N6/c47-22-19-34(10-1-13(40(59,60)61)7-14(2-10)41(62,63)64)77-80(37(19)31(56)28(53)25(22)50)46(81-38-20(23(48)26(51)29(54)32(38)57)35(78-81)11-3-15(42(65,66)67)8-16(4-11)43(68,69)70)82-39-21(24(49)27(52)30(55)33(39)58)36(79-82)12-5-17(44(71,72)73)9-18(6-12)45(74,75)76/h1-9,46H/q-1 |
| InChIKey | RGSUUBDDFGOASN-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1215.37 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|