C14H12F6N2 — CID 102168707
4-[3,5-bis(trifluoromethyl)phenyl]-1,3,5-trimethylpyrazole (PubChem CID 102168707) has the molecular formula C14H12F6N2 and a molecular weight of 322.25 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-1,3,5-trimethylpyrazole.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 102168707 |
| Molecular Formula | C14H12F6N2 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F6N2/c1-7-12(8(2)22(3)21-7)9-4-10(13(15,16)17)6-11(5-9)14(18,19)20/h4-6H,1-3H3 |
| InChIKey | WXNXGAQXJSCMTR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |