C20H17F3N2O — CID 59493120
9-(trifluoromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)fluoren-9-ol (PubChem CID 59493120) has the molecular formula C20H17F3N2O and a molecular weight of 358.36 g/mol. Its IUPAC name is 9-(trifluoromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)fluoren-9-ol.
| Compound Name | 9-(trifluoromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)fluoren-9-ol |
|---|---|
| PubChem CID | 59493120 |
| Molecular Formula | C20H17F3N2O |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 9-(trifluoromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)fluoren-9-ol |
| SMILES | Cc1nn(C)c(C)c1-c1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C20H17F3N2O/c1-11-18(12(2)25(3)24-11)13-8-9-15-14-6-4-5-7-16(14)19(26,17(15)10-13)20(21,22)23/h4-10,26H,1-3H3 |
| InChIKey | YJJSLNXEVHRLLG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |