C15H8F6O — CID 59492966
4,9-bis(trifluoromethyl)fluoren-9-ol (PubChem CID 59492966) has the molecular formula C15H8F6O and a molecular weight of 318.22 g/mol. Its IUPAC name is 4,9-bis(trifluoromethyl)fluoren-9-ol.
| Compound Name | 4,9-bis(trifluoromethyl)fluoren-9-ol |
|---|---|
| PubChem CID | 59492966 |
| Molecular Formula | C15H8F6O |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4,9-bis(trifluoromethyl)fluoren-9-ol |
| SMILES | OC1(C(F)(F)F)c2ccccc2-c2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C15H8F6O/c16-14(17,18)11-7-3-6-10-12(11)8-4-1-2-5-9(8)13(10,22)15(19,20)21/h1-7,22H |
| InChIKey | SHQWUFLVCKLLRQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |