C18H11F3N2O2 — CID 118119254
4-(2-methanimidoyl-1,3-oxazol-5-yl)-9-(trifluoromethyl)fluoren-9-ol (PubChem CID 118119254) has the molecular formula C18H11F3N2O2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 4-(2-methanimidoyl-1,3-oxazol-5-yl)-9-(trifluoromethyl)fluoren-9-ol.
| Compound Name | 4-(2-methanimidoyl-1,3-oxazol-5-yl)-9-(trifluoromethyl)fluoren-9-ol |
|---|---|
| PubChem CID | 118119254 |
| Molecular Formula | C18H11F3N2O2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-(2-methanimidoyl-1,3-oxazol-5-yl)-9-(trifluoromethyl)fluoren-9-ol |
| SMILES | [H]/N=C/c1ncc(-c2cccc3c2-c2ccccc2C3(O)C(F)(F)F)o1 |
| InChI | InChI=1S/C18H11F3N2O2/c19-18(20,21)17(24)12-6-2-1-4-10(12)16-11(5-3-7-13(16)17)14-9-23-15(8-22)25-14/h1-9,22,24H/b22-8+ |
| InChIKey | QOQMEYBVVRSZEH-GZIVZEMBSA-N |
| XLogP | 4.12 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|