C21H19F3N2O — CID 59492700
4-[1-(2-methylpropyl)pyrazol-4-yl]-9-(trifluoromethyl)fluoren-9-ol (PubChem CID 59492700) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-[1-(2-methylpropyl)pyrazol-4-yl]-9-(trifluoromethyl)fluoren-9-ol.
| Compound Name | 4-[1-(2-methylpropyl)pyrazol-4-yl]-9-(trifluoromethyl)fluoren-9-ol |
|---|---|
| PubChem CID | 59492700 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-[1-(2-methylpropyl)pyrazol-4-yl]-9-(trifluoromethyl)fluoren-9-ol |
| SMILES | CC(C)Cn1cc(-c2cccc3c2-c2ccccc2C3(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H19F3N2O/c1-13(2)11-26-12-14(10-25-26)15-7-5-9-18-19(15)16-6-3-4-8-17(16)20(18,27)21(22,23)24/h3-10,12-13,27H,11H2,1-2H3 |
| InChIKey | DSZQCRPLNNDNGR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |