C22H22F3N3O3S — CID 59492886
N-[3-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]propyl]methanesulfonamide (PubChem CID 59492886) has the molecular formula C22H22F3N3O3S and a molecular weight of 465.50 g/mol. Its IUPAC name is N-[3-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 59492886 |
| Molecular Formula | C22H22F3N3O3S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[3-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]propyl]methanesulfonamide |
| SMILES | Cc1cc(-c2cnn(CCCNS(C)(=O)=O)c2)c2c(c1)[C@@](O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C22H22F3N3O3S/c1-14-10-17(15-12-26-28(13-15)9-5-8-27-32(2,30)31)20-16-6-3-4-7-18(16)21(29,19(20)11-14)22(23,24)25/h3-4,6-7,10-13,27,29H,5,8-9H2,1-2H3/t21-/m1/s1 |
| InChIKey | JKFPZRASTXNGRU-OAQYLSRUSA-N |
| XLogP | 3.58 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|