C23H21F3N2O2 — CID 71164723
5-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]pentan-2-one (PubChem CID 71164723) has the molecular formula C23H21F3N2O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 5-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]pentan-2-one.
| Compound Name | 5-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]pentan-2-one |
|---|---|
| PubChem CID | 71164723 |
| Molecular Formula | C23H21F3N2O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 5-[4-[(9R)-9-hydroxy-2-methyl-9-(trifluoromethyl)fluoren-4-yl]pyrazol-1-yl]pentan-2-one |
| SMILES | CC(=O)CCCn1cc(-c2cc(C)cc3c2-c2ccccc2[C@]3(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C23H21F3N2O2/c1-14-10-18(16-12-27-28(13-16)9-5-6-15(2)29)21-17-7-3-4-8-19(17)22(30,20(21)11-14)23(24,25)26/h3-4,7-8,10-13,30H,5-6,9H2,1-2H3/t22-/m1/s1 |
| InChIKey | GLBCWUPOYIXXMH-JOCHJYFZSA-N |
| XLogP | 5.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |