C12H13ClN2 — CID 142305322
4-(4-chlorophenyl)-1,3,5-trimethylpyrazole (PubChem CID 142305322) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,3,5-trimethylpyrazole.
| Compound Name | 4-(4-chlorophenyl)-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 142305322 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-(4-chlorophenyl)-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2/c1-8-12(9(2)15(3)14-8)10-4-6-11(13)7-5-10/h4-7H,1-3H3 |
| InChIKey | KQOKIBCKLWPEQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |