C20H7BF13- — CID 162180595
[3-methyl-5-(trifluoromethyl)phenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 162180595) has the molecular formula C20H7BF13- and a molecular weight of 505.06 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 162180595 |
| Molecular Formula | C20H7BF13- |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1cc([BH-](c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H7BF13/c1-5-2-6(20(32,33)34)4-7(3-5)21(8-10(22)14(26)18(30)15(27)11(8)23)9-12(24)16(28)19(31)17(29)13(9)25/h2-4,21H,1H3/q-1 |
| InChIKey | MYYAPSRHFVLTOG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|