C24H24F3S+ — CID 163603392
bis(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium (PubChem CID 163603392) has the molecular formula C24H24F3S+ and a molecular weight of 401.52 g/mol. Its IUPAC name is bis(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | bis(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 163603392 |
| Molecular Formula | C24H24F3S+ |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | bis(3,5-dimethylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium |
| SMILES | Cc1cc(C)cc([S+](c2cc(C)cc(C)c2)c2cc(C)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H24F3S/c1-15-6-16(2)10-21(9-15)28(22-11-17(3)7-18(4)12-22)23-13-19(5)8-20(14-23)24(25,26)27/h6-14H,1-5H3/q+1 |
| InChIKey | BUIMSPQIAPJIHF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|