C22H20F3O4S3+ — CID 157242036
bis(3-methylsulfonylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium (PubChem CID 157242036) has the molecular formula C22H20F3O4S3+ and a molecular weight of 501.59 g/mol. Its IUPAC name is bis(3-methylsulfonylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | bis(3-methylsulfonylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 157242036 |
| Molecular Formula | C22H20F3O4S3+ |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | bis(3-methylsulfonylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium |
| SMILES | Cc1cc([S+](c2cccc(S(C)(=O)=O)c2)c2cccc(S(C)(=O)=O)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3O4S3/c1-15-10-16(22(23,24)25)12-19(11-15)30(17-6-4-8-20(13-17)31(2,26)27)18-7-5-9-21(14-18)32(3,28)29/h4-14H,1-3H3/q+1 |
| InChIKey | ZRUVFLWUYFHONO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|