C28H32F3S+ — CID 163603393
bis(4-tert-butylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium (PubChem CID 163603393) has the molecular formula C28H32F3S+ and a molecular weight of 457.63 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | bis(4-tert-butylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 163603393 |
| Molecular Formula | C28H32F3S+ |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | bis(4-tert-butylphenyl)-[3-methyl-5-(trifluoromethyl)phenyl]sulfanium |
| SMILES | Cc1cc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32F3S/c1-19-16-22(28(29,30)31)18-25(17-19)32(23-12-8-20(9-13-23)26(2,3)4)24-14-10-21(11-15-24)27(5,6)7/h8-18H,1-7H3/q+1 |
| InChIKey | XOPJBUMJJAAMLL-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|