C23H22F3S+ — CID 163549423
(4-methylphenyl)-[4-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)sulfanium (PubChem CID 163549423) has the molecular formula C23H22F3S+ and a molecular weight of 387.49 g/mol. Its IUPAC name is (4-methylphenyl)-[4-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)sulfanium.
| Compound Name | (4-methylphenyl)-[4-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)sulfanium |
|---|---|
| PubChem CID | 163549423 |
| Molecular Formula | C23H22F3S+ |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (4-methylphenyl)-[4-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)sulfanium |
| SMILES | Cc1ccc([S+](c2ccc(C(F)(F)F)cc2)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H22F3S/c1-15-5-9-20(10-6-15)27(22-17(3)13-16(2)14-18(22)4)21-11-7-19(8-12-21)23(24,25)26/h5-14H,1-4H3/q+1 |
| InChIKey | SMCXXDMJLUZWAH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|