C26H31S+ — CID 58658264
(4-tert-butyl-2,6-dimethylphenyl)-bis(4-methylphenyl)sulfanium (PubChem CID 58658264) has the molecular formula C26H31S+ and a molecular weight of 375.60 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-bis(4-methylphenyl)sulfanium.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-bis(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 58658264 |
| Molecular Formula | C26H31S+ |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-bis(4-methylphenyl)sulfanium |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2c(C)cc(C(C)(C)C)cc2C)cc1 |
| InChI | InChI=1S/C26H31S/c1-18-8-12-23(13-9-18)27(24-14-10-19(2)11-15-24)25-20(3)16-22(17-21(25)4)26(5,6)7/h8-17H,1-7H3/q+1 |
| InChIKey | UTIGNRFKEHBFID-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|