C15H20F6 — CID 145201590
1-methyl-3,5-bis(trifluoromethyl)benzene;propane;prop-1-ene (PubChem CID 145201590) has the molecular formula C15H20F6 and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-methyl-3,5-bis(trifluoromethyl)benzene;propane;prop-1-ene.
| Compound Name | 1-methyl-3,5-bis(trifluoromethyl)benzene;propane;prop-1-ene |
|---|---|
| PubChem CID | 145201590 |
| Molecular Formula | C15H20F6 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-methyl-3,5-bis(trifluoromethyl)benzene;propane;prop-1-ene |
| SMILES | C=CC.CCC.Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F6.C3H8.C3H6/c1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15;2*1-3-2/h2-4H,1H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | LSHXSRYTCMIUFS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|