C12H16F3N — CID 118333519
N-tert-butyl-3-methyl-5-(trifluoromethyl)aniline (PubChem CID 118333519) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is N-tert-butyl-3-methyl-5-(trifluoromethyl)aniline.
| Compound Name | N-tert-butyl-3-methyl-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 118333519 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-tert-butyl-3-methyl-5-(trifluoromethyl)aniline |
| SMILES | Cc1cc(NC(C)(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N/c1-8-5-9(12(13,14)15)7-10(6-8)16-11(2,3)4/h5-7,16H,1-4H3 |
| InChIKey | MEASBWAGBYBUJA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |