C17H20F3N — CID 143881938
N-[(1Z,3Z,5E)-2,3-dimethylhepta-1,3,5-trienyl]-3-methyl-5-(trifluoromethyl)aniline (PubChem CID 143881938) has the molecular formula C17H20F3N and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[(1Z,3Z,5E)-2,3-dimethylhepta-1,3,5-trienyl]-3-methyl-5-(trifluoromethyl)aniline.
| Compound Name | N-[(1Z,3Z,5E)-2,3-dimethylhepta-1,3,5-trienyl]-3-methyl-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 143881938 |
| Molecular Formula | C17H20F3N |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-[(1Z,3Z,5E)-2,3-dimethylhepta-1,3,5-trienyl]-3-methyl-5-(trifluoromethyl)aniline |
| SMILES | C/C=C/C=C(C)\C(C)=C/Nc1cc(C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3N/c1-5-6-7-13(3)14(4)11-21-16-9-12(2)8-15(10-16)17(18,19)20/h5-11,21H,1-4H3/b6-5+,13-7-,14-11- |
| InChIKey | WUBHMDLJSZWHNB-RPTQVTDJSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|