C19H7BF10 — CID 177045807
(2,4-difluoro-5-methylphenyl)-bis(2,3,5,6-tetrafluorophenyl)borane (PubChem CID 177045807) has the molecular formula C19H7BF10 and a molecular weight of 436.06 g/mol. Its IUPAC name is (2,4-difluoro-5-methylphenyl)-bis(2,3,5,6-tetrafluorophenyl)borane.
| Compound Name | (2,4-difluoro-5-methylphenyl)-bis(2,3,5,6-tetrafluorophenyl)borane |
|---|---|
| PubChem CID | 177045807 |
| Molecular Formula | C19H7BF10 |
| Molecular Weight | 436.06 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | (2,4-difluoro-5-methylphenyl)-bis(2,3,5,6-tetrafluorophenyl)borane |
| SMILES | Cc1cc(B(c2c(F)c(F)cc(F)c2F)c2c(F)c(F)cc(F)c2F)c(F)cc1F |
| InChI | InChI=1S/C19H7BF10/c1-6-2-7(9(22)3-8(6)21)20(14-16(27)10(23)4-11(24)17(14)28)15-18(29)12(25)5-13(26)19(15)30/h2-5H,1H3 |
| InChIKey | BHPYTNPBFKCBNS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.06 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|