C15H8F8S2 — CID 155020098
1-ethylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene (PubChem CID 155020098) has the molecular formula C15H8F8S2 and a molecular weight of 404.35 g/mol. Its IUPAC name is 1-ethylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene.
| Compound Name | 1-ethylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene |
|---|---|
| PubChem CID | 155020098 |
| Molecular Formula | C15H8F8S2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 1-ethylsulfanyl-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene |
| SMILES | CCSc1c(F)c(F)c(-c2c(F)c(F)c(SC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H8F8S2/c1-3-25-15-12(22)8(18)5(9(19)13(15)23)4-6(16)10(20)14(24-2)11(21)7(4)17/h3H2,1-2H3 |
| InChIKey | DWVWVHWVSNMYOM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|