C8H7F4NS — CID 134575464
4-ethylsulfanyl-2,3,5,6-tetrafluoroaniline (PubChem CID 134575464) has the molecular formula C8H7F4NS and a molecular weight of 225.21 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,3,5,6-tetrafluoroaniline.
| Compound Name | 4-ethylsulfanyl-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 134575464 |
| Molecular Formula | C8H7F4NS |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 4-ethylsulfanyl-2,3,5,6-tetrafluoroaniline |
| SMILES | CCSc1c(F)c(F)c(N)c(F)c1F |
| InChI | InChI=1S/C8H7F4NS/c1-2-14-8-5(11)3(9)7(13)4(10)6(8)12/h2,13H2,1H3 |
| InChIKey | FREXNXVYLJHXKG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|