C17H8F8OS — CID 118963341
1-but-3-ynoxy-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene (PubChem CID 118963341) has the molecular formula C17H8F8OS and a molecular weight of 412.30 g/mol. Its IUPAC name is 1-but-3-ynoxy-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene.
| Compound Name | 1-but-3-ynoxy-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene |
|---|---|
| PubChem CID | 118963341 |
| Molecular Formula | C17H8F8OS |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 1-but-3-ynoxy-2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylsulfanylphenyl)benzene |
| SMILES | C#CCCOc1c(F)c(F)c(-c2c(F)c(F)c(SC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H8F8OS/c1-3-4-5-26-16-12(22)8(18)6(9(19)13(16)23)7-10(20)14(24)17(27-2)15(25)11(7)21/h1H,4-5H2,2H3 |
| InChIKey | YXAHBTPBFRTWII-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|