About 4-but-3-ynoxy-3,5-difluorobenzonitrile
4-but-3-ynoxy-3,5-difluorobenzonitrile (PubChem CID 106794959) has the molecular formula C11H7F2NO
and a molecular weight of 207.18 g/mol. Its IUPAC name is 4-but-3-ynoxy-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-but-3-ynoxy-3,5-difluorobenzonitrile |
| PubChem CID | 106794959 |
| Molecular Formula | C11H7F2NO |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4-but-3-ynoxy-3,5-difluorobenzonitrile |
| SMILES | C#CCCOc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C11H7F2NO/c1-2-3-4-15-11-9(12)5-8(7-14)6-10(11)13/h1,5-6H,3-4H2 |
| InChIKey | DLAHVIKAQGLITB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-ynoxy-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-ynoxy-3,5-difluorobenzonitrile?
The IUPAC name of 4-but-3-ynoxy-3,5-difluorobenzonitrile (CID 106794959) is 4-but-3-ynoxy-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-but-3-ynoxy-3,5-difluorobenzonitrile?
The canonical SMILES for 4-but-3-ynoxy-3,5-difluorobenzonitrile is C#CCCOc1c(F)cc(C#N)cc1F.
What is the InChIKey of 4-but-3-ynoxy-3,5-difluorobenzonitrile?
The InChIKey is DLAHVIKAQGLITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2NO/c1-2-3-4-15-11-9(12)5-8(7-14)6-10(11)13/h1,5-6H,3-4H2.
What are the key properties of 4-but-3-ynoxy-3,5-difluorobenzonitrile?
4-but-3-ynoxy-3,5-difluorobenzonitrile has a molecular weight of 207.18 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-ynoxy-3,5-difluorobenzonitrile is sourced from PubChem (CID 106794959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).