C10H8F2O — CID 63656648
4-but-3-ynoxy-1,2-difluorobenzene (PubChem CID 63656648) has the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-but-3-ynoxy-1,2-difluorobenzene.
| Compound Name | 4-but-3-ynoxy-1,2-difluorobenzene |
|---|---|
| PubChem CID | 63656648 |
| Molecular Formula | C10H8F2O |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-but-3-ynoxy-1,2-difluorobenzene |
| SMILES | C#CCCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H8F2O/c1-2-3-6-13-8-4-5-9(11)10(12)7-8/h1,4-5,7H,3,6H2 |
| InChIKey | DIHZPEOJKZJVJP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|