About 4-but-3-ynoxyphenol
4-but-3-ynoxyphenol (PubChem CID 43143414) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-but-3-ynoxyphenol.
Molecular Properties
| Compound Name | 4-but-3-ynoxyphenol |
| PubChem CID | 43143414 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 4-but-3-ynoxyphenol |
| SMILES | C#CCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C10H10O2/c1-2-3-8-12-10-6-4-9(11)5-7-10/h1,4-7,11H,3,8H2 |
| InChIKey | OLBRQAZCEOKOKT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-ynoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-ynoxyphenol?
The IUPAC name of 4-but-3-ynoxyphenol (CID 43143414) is 4-but-3-ynoxyphenol.
What is the SMILES notation for 4-but-3-ynoxyphenol?
The canonical SMILES for 4-but-3-ynoxyphenol is C#CCCOc1ccc(O)cc1.
What is the InChIKey of 4-but-3-ynoxyphenol?
The InChIKey is OLBRQAZCEOKOKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-3-8-12-10-6-4-9(11)5-7-10/h1,4-7,11H,3,8H2.
What are the key properties of 4-but-3-ynoxyphenol?
4-but-3-ynoxyphenol has a molecular weight of 162.19 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-ynoxyphenol is sourced from PubChem (CID 43143414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).