About 4-oct-7-ynoxyphenol
4-oct-7-ynoxyphenol (PubChem CID 166068897) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-oct-7-ynoxyphenol.
Molecular Properties
| Compound Name | 4-oct-7-ynoxyphenol |
| PubChem CID | 166068897 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-oct-7-ynoxyphenol |
| SMILES | C#CCCCCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-5-6-7-12-16-14-10-8-13(15)9-11-14/h1,8-11,15H,3-7,12H2 |
| InChIKey | WMPWBJFTNRKISN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-oct-7-ynoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oct-7-ynoxyphenol?
The IUPAC name of 4-oct-7-ynoxyphenol (CID 166068897) is 4-oct-7-ynoxyphenol.
What is the SMILES notation for 4-oct-7-ynoxyphenol?
The canonical SMILES for 4-oct-7-ynoxyphenol is C#CCCCCCCOc1ccc(O)cc1.
What is the InChIKey of 4-oct-7-ynoxyphenol?
The InChIKey is WMPWBJFTNRKISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-3-4-5-6-7-12-16-14-10-8-13(15)9-11-14/h1,8-11,15H,3-7,12H2.
What are the key properties of 4-oct-7-ynoxyphenol?
4-oct-7-ynoxyphenol has a molecular weight of 218.30 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oct-7-ynoxyphenol is sourced from PubChem (CID 166068897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).