C14H8F2O — CID 138985519
4-(4-ethynylphenoxy)-1,2-difluorobenzene (PubChem CID 138985519) has the molecular formula C14H8F2O and a molecular weight of 230.21 g/mol. Its IUPAC name is 4-(4-ethynylphenoxy)-1,2-difluorobenzene.
| Compound Name | 4-(4-ethynylphenoxy)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 138985519 |
| Molecular Formula | C14H8F2O |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-(4-ethynylphenoxy)-1,2-difluorobenzene |
| SMILES | C#Cc1ccc(Oc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H8F2O/c1-2-10-3-5-11(6-4-10)17-12-7-8-13(15)14(16)9-12/h1,3-9H |
| InChIKey | KXSIMALYEVDKBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|