C40H46FNO — CID 158890881
1-tert-butyl-3-ethynylbenzene;2-tert-butyl-1-fluoro-4-methylbenzene;4-(3-tert-butylphenoxy)benzonitrile (PubChem CID 158890881) has the molecular formula C40H46FNO and a molecular weight of 575.81 g/mol. Its IUPAC name is 1-tert-butyl-3-ethynylbenzene;2-tert-butyl-1-fluoro-4-methylbenzene;4-(3-tert-butylphenoxy)benzonitrile.
| Compound Name | 1-tert-butyl-3-ethynylbenzene;2-tert-butyl-1-fluoro-4-methylbenzene;4-(3-tert-butylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 158890881 |
| Molecular Formula | C40H46FNO |
| Molecular Weight | 575.81 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | 1-tert-butyl-3-ethynylbenzene;2-tert-butyl-1-fluoro-4-methylbenzene;4-(3-tert-butylphenoxy)benzonitrile |
| SMILES | C#Cc1cccc(C(C)(C)C)c1.CC(C)(C)c1cccc(Oc2ccc(C#N)cc2)c1.Cc1ccc(F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H17NO.C12H14.C11H15F/c1-17(2,3)14-5-4-6-16(11-14)19-15-9-7-13(12-18)8-10-15;1-5-10-7-6-8-11(9-10)12(2,3)4;1-8-5-6-10(12)9(7-8)11(2,3)4/h4-11H,1-3H3;1,6-9H,2-4H3;5-7H,1-4H3 |
| InChIKey | JEFJAQZJMJZDKG-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.81 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|