C17H17NO — CID 115481441
3-[1-(2,5-dimethylphenyl)-1-hydroxyethyl]benzonitrile (PubChem CID 115481441) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[1-(2,5-dimethylphenyl)-1-hydroxyethyl]benzonitrile.
| Compound Name | 3-[1-(2,5-dimethylphenyl)-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 115481441 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[1-(2,5-dimethylphenyl)-1-hydroxyethyl]benzonitrile |
| SMILES | Cc1ccc(C)c(C(C)(O)c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C17H17NO/c1-12-7-8-13(2)16(9-12)17(3,19)15-6-4-5-14(10-15)11-18/h4-10,19H,1-3H3 |
| InChIKey | QOMCANUAOJNIHZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |