C18H17NO2 — CID 114743649
3-[1-(3,4-dihydro-2H-chromen-8-yl)-1-hydroxyethyl]benzonitrile (PubChem CID 114743649) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[1-(3,4-dihydro-2H-chromen-8-yl)-1-hydroxyethyl]benzonitrile.
| Compound Name | 3-[1-(3,4-dihydro-2H-chromen-8-yl)-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 114743649 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[1-(3,4-dihydro-2H-chromen-8-yl)-1-hydroxyethyl]benzonitrile |
| SMILES | CC(O)(c1cccc(C#N)c1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C18H17NO2/c1-18(20,15-8-2-5-13(11-15)12-19)16-9-3-6-14-7-4-10-21-17(14)16/h2-3,5-6,8-9,11,20H,4,7,10H2,1H3 |
| InChIKey | HSSVJTRVFLHQKV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |