C15H16O3 — CID 114743643
1-(3,4-dihydro-2H-chromen-8-yl)-1-(furan-3-yl)ethanol (PubChem CID 114743643) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-1-(furan-3-yl)ethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-1-(furan-3-yl)ethanol |
|---|---|
| PubChem CID | 114743643 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-1-(furan-3-yl)ethanol |
| SMILES | CC(O)(c1ccoc1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H16O3/c1-15(16,12-7-9-17-10-12)13-6-2-4-11-5-3-8-18-14(11)13/h2,4,6-7,9-10,16H,3,5,8H2,1H3 |
| InChIKey | RYPPUJXEKKWLSX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |