C16H16FNO2 — CID 114743705
1-(3,4-dihydro-2H-chromen-8-yl)-1-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 114743705) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-1-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-1-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 114743705 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-1-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | CC(O)(c1ccc(F)cn1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H16FNO2/c1-16(19,14-8-7-12(17)10-18-14)13-6-2-4-11-5-3-9-20-15(11)13/h2,4,6-8,10,19H,3,5,9H2,1H3 |
| InChIKey | FQZUWIVUMGQMGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |