C64H42O12S3 — CID 20521209
1-ethynyl-3-[4-[4-[4-[4-[4-[3-[4-[4-(4-ethynylphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]benzene (PubChem CID 20521209) has the molecular formula C64H42O12S3 and a molecular weight of 1099.23 g/mol. Its IUPAC name is 1-ethynyl-3-[4-[4-[4-[4-[4-[3-[4-[4-(4-ethynylphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]benzene.
| Compound Name | 1-ethynyl-3-[4-[4-[4-[4-[4-[3-[4-[4-(4-ethynylphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]benzene |
|---|---|
| PubChem CID | 20521209 |
| Molecular Formula | C64H42O12S3 |
| Molecular Weight | 1099.23 g/mol |
| Exact Mass | 1098.18 |
| IUPAC Name | 1-ethynyl-3-[4-[4-[4-[4-[4-[3-[4-[4-(4-ethynylphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonylphenoxy]benzene |
| SMILES | C#Cc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(Oc5ccc(S(=O)(=O)c6ccc(Oc7ccc(Oc8ccc(S(=O)(=O)c9ccc(Oc%10cccc(C#C)c%10)cc9)cc8)cc7)cc6)cc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C64H42O12S3/c1-3-45-11-13-47(14-12-45)71-50-19-31-59(32-20-50)78(67,68)63-39-27-54(28-40-63)75-57-9-6-10-58(44-57)76-55-29-41-64(42-30-55)79(69,70)61-35-23-52(24-36-61)73-49-17-15-48(16-18-49)72-51-21-33-60(34-22-51)77(65,66)62-37-25-53(26-38-62)74-56-8-5-7-46(4-2)43-56/h1-2,5-44H |
| InChIKey | AXZSNCFTHIKXBB-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.23 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|