C30H22O4S — CID 20520975
1-ethynyl-3-[4-[4-(3-ethynyl-5-methylphenoxy)phenyl]sulfonylphenoxy]-2-methylbenzene (PubChem CID 20520975) has the molecular formula C30H22O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is 1-ethynyl-3-[4-[4-(3-ethynyl-5-methylphenoxy)phenyl]sulfonylphenoxy]-2-methylbenzene.
| Compound Name | 1-ethynyl-3-[4-[4-(3-ethynyl-5-methylphenoxy)phenyl]sulfonylphenoxy]-2-methylbenzene |
|---|---|
| PubChem CID | 20520975 |
| Molecular Formula | C30H22O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 1-ethynyl-3-[4-[4-(3-ethynyl-5-methylphenoxy)phenyl]sulfonylphenoxy]-2-methylbenzene |
| SMILES | C#Cc1cc(C)cc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(C#C)c4C)cc3)cc2)c1 |
| InChI | InChI=1S/C30H22O4S/c1-5-23-18-21(3)19-27(20-23)33-25-10-14-28(15-11-25)35(31,32)29-16-12-26(13-17-29)34-30-9-7-8-24(6-2)22(30)4/h1-2,7-20H,3-4H3 |
| InChIKey | DCIZGHDFPQWEJO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|