C34H30O6S — CID 20521102
4-[3-[4-[2-[3-(3-hydroxy-3-methylbut-1-ynyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 20521102) has the molecular formula C34H30O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is 4-[3-[4-[2-[3-(3-hydroxy-3-methylbut-1-ynyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[4-[2-[3-(3-hydroxy-3-methylbut-1-ynyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 20521102 |
| Molecular Formula | C34H30O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 4-[3-[4-[2-[3-(3-hydroxy-3-methylbut-1-ynyl)phenoxy]phenyl]sulfonylphenoxy]phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1cccc(Oc2ccc(S(=O)(=O)c3ccccc3Oc3cccc(C#CC(C)(C)O)c3)cc2)c1 |
| InChI | InChI=1S/C34H30O6S/c1-33(2,35)21-19-25-9-7-11-28(23-25)39-27-15-17-30(18-16-27)41(37,38)32-14-6-5-13-31(32)40-29-12-8-10-26(24-29)20-22-34(3,4)36/h5-18,23-24,35-36H,1-4H3 |
| InChIKey | VUUMFOAENNNANZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|