C19H19FO2 — CID 21322207
5-[3-(4-fluorophenoxy)phenyl]-2,3-dimethylpent-4-yn-2-ol (PubChem CID 21322207) has the molecular formula C19H19FO2 and a molecular weight of 298.36 g/mol. Its IUPAC name is 5-[3-(4-fluorophenoxy)phenyl]-2,3-dimethylpent-4-yn-2-ol.
| Compound Name | 5-[3-(4-fluorophenoxy)phenyl]-2,3-dimethylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 21322207 |
| Molecular Formula | C19H19FO2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-[3-(4-fluorophenoxy)phenyl]-2,3-dimethylpent-4-yn-2-ol |
| SMILES | CC(C#Cc1cccc(Oc2ccc(F)cc2)c1)C(C)(C)O |
| InChI | InChI=1S/C19H19FO2/c1-14(19(2,3)21)7-8-15-5-4-6-18(13-15)22-17-11-9-16(20)10-12-17/h4-6,9-14,21H,1-3H3 |
| InChIKey | IXYUHKQFHSPTFY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|